C27H29BrN2O3S — CID 17097451
3-bromo-N-[[3-(3-methylbutoxy)phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide (PubChem CID 17097451) has the molecular formula C27H29BrN2O3S and a molecular weight of 541.51 g/mol. Its IUPAC name is 3-bromo-N-[[3-(3-methylbutoxy)phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide.
| Compound Name | 3-bromo-N-[[3-(3-methylbutoxy)phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17097451 |
| Molecular Formula | C27H29BrN2O3S |
| Molecular Weight | 541.51 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | 3-bromo-N-[[3-(3-methylbutoxy)phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide |
| SMILES | CC(C)CCOc1cccc(NC(=S)NC(=O)c2ccc(OCCc3ccccc3)c(Br)c2)c1 |
| InChI | InChI=1S/C27H29BrN2O3S/c1-19(2)13-15-32-23-10-6-9-22(18-23)29-27(34)30-26(31)21-11-12-25(24(28)17-21)33-16-14-20-7-4-3-5-8-20/h3-12,17-19H,13-16H2,1-2H3,(H2,29,30,31,34) |
| InChIKey | GYUXEXDKEPVQBI-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.51 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|