C29H25BrN2O3S — CID 17086254
3-bromo-4-(2-phenylethoxy)-N-[(3-phenylmethoxyphenyl)carbamothioyl]benzamide (PubChem CID 17086254) has the molecular formula C29H25BrN2O3S and a molecular weight of 561.50 g/mol. Its IUPAC name is 3-bromo-4-(2-phenylethoxy)-N-[(3-phenylmethoxyphenyl)carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-(2-phenylethoxy)-N-[(3-phenylmethoxyphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17086254 |
| Molecular Formula | C29H25BrN2O3S |
| Molecular Weight | 561.50 g/mol |
| Exact Mass | 560.08 |
| IUPAC Name | 3-bromo-4-(2-phenylethoxy)-N-[(3-phenylmethoxyphenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cccc(OCc2ccccc2)c1)c1ccc(OCCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C29H25BrN2O3S/c30-26-18-23(14-15-27(26)34-17-16-21-8-3-1-4-9-21)28(33)32-29(36)31-24-12-7-13-25(19-24)35-20-22-10-5-2-6-11-22/h1-15,18-19H,16-17,20H2,(H2,31,32,33,36) |
| InChIKey | OENDUBJFKVDNHW-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.50 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|