C31H30N2O3S — CID 17134789
3-(2-phenylethoxy)-N-[[3-(3-phenylpropoxy)phenyl]carbamothioyl]benzamide (PubChem CID 17134789) has the molecular formula C31H30N2O3S and a molecular weight of 510.66 g/mol. Its IUPAC name is 3-(2-phenylethoxy)-N-[[3-(3-phenylpropoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-(2-phenylethoxy)-N-[[3-(3-phenylpropoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17134789 |
| Molecular Formula | C31H30N2O3S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 3-(2-phenylethoxy)-N-[[3-(3-phenylpropoxy)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cccc(OCCCc2ccccc2)c1)c1cccc(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C31H30N2O3S/c34-30(26-15-7-17-28(22-26)36-21-19-25-12-5-2-6-13-25)33-31(37)32-27-16-8-18-29(23-27)35-20-9-14-24-10-3-1-4-11-24/h1-8,10-13,15-18,22-23H,9,14,19-21H2,(H2,32,33,34,37) |
| InChIKey | MFRFPNOTAGLFKK-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|