C23H21FN2O2S — CID 17133406
2-fluoro-N-[[3-(3-phenylpropoxy)phenyl]carbamothioyl]benzamide (PubChem CID 17133406) has the molecular formula C23H21FN2O2S and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-fluoro-N-[[3-(3-phenylpropoxy)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-fluoro-N-[[3-(3-phenylpropoxy)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17133406 |
| Molecular Formula | C23H21FN2O2S |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2-fluoro-N-[[3-(3-phenylpropoxy)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cccc(OCCCc2ccccc2)c1)c1ccccc1F |
| InChI | InChI=1S/C23H21FN2O2S/c24-21-14-5-4-13-20(21)22(27)26-23(29)25-18-11-6-12-19(16-18)28-15-7-10-17-8-2-1-3-9-17/h1-6,8-9,11-14,16H,7,10,15H2,(H2,25,26,27,29) |
| InChIKey | SKSNCWXOLGMIFR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|