C23H22N2O2S — CID 17142302
2-phenyl-N-[[3-(2-phenylethoxy)phenyl]carbamothioyl]acetamide (PubChem CID 17142302) has the molecular formula C23H22N2O2S and a molecular weight of 390.51 g/mol. Its IUPAC name is 2-phenyl-N-[[3-(2-phenylethoxy)phenyl]carbamothioyl]acetamide.
| Compound Name | 2-phenyl-N-[[3-(2-phenylethoxy)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 17142302 |
| Molecular Formula | C23H22N2O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 2-phenyl-N-[[3-(2-phenylethoxy)phenyl]carbamothioyl]acetamide |
| SMILES | O=C(Cc1ccccc1)NC(=S)Nc1cccc(OCCc2ccccc2)c1 |
| InChI | InChI=1S/C23H22N2O2S/c26-22(16-19-10-5-2-6-11-19)25-23(28)24-20-12-7-13-21(17-20)27-15-14-18-8-3-1-4-9-18/h1-13,17H,14-16H2,(H2,24,25,26,28) |
| InChIKey | RVFWIBMLAYXTIZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|