C28H30N2O4S — CID 17133389
2-phenylethyl 4-oxo-4-[[3-(3-phenylpropoxy)phenyl]carbamothioylamino]butanoate (PubChem CID 17133389) has the molecular formula C28H30N2O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is 2-phenylethyl 4-oxo-4-[[3-(3-phenylpropoxy)phenyl]carbamothioylamino]butanoate.
| Compound Name | 2-phenylethyl 4-oxo-4-[[3-(3-phenylpropoxy)phenyl]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 17133389 |
| Molecular Formula | C28H30N2O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 2-phenylethyl 4-oxo-4-[[3-(3-phenylpropoxy)phenyl]carbamothioylamino]butanoate |
| SMILES | O=C(CCC(=O)OCCc1ccccc1)NC(=S)Nc1cccc(OCCCc2ccccc2)c1 |
| InChI | InChI=1S/C28H30N2O4S/c31-26(16-17-27(32)34-20-18-23-11-5-2-6-12-23)30-28(35)29-24-14-7-15-25(21-24)33-19-8-13-22-9-3-1-4-10-22/h1-7,9-12,14-15,21H,8,13,16-20H2,(H2,29,30,31,35) |
| InChIKey | IKYXEBVECLAJQP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|