C27H29NO4 — CID 17133245
2-phenylethyl 4-oxo-4-[3-(3-phenylpropoxy)anilino]butanoate (PubChem CID 17133245) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is 2-phenylethyl 4-oxo-4-[3-(3-phenylpropoxy)anilino]butanoate.
| Compound Name | 2-phenylethyl 4-oxo-4-[3-(3-phenylpropoxy)anilino]butanoate |
|---|---|
| PubChem CID | 17133245 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 2-phenylethyl 4-oxo-4-[3-(3-phenylpropoxy)anilino]butanoate |
| SMILES | O=C(CCC(=O)OCCc1ccccc1)Nc1cccc(OCCCc2ccccc2)c1 |
| InChI | InChI=1S/C27H29NO4/c29-26(16-17-27(30)32-20-18-23-11-5-2-6-12-23)28-24-14-7-15-25(21-24)31-19-8-13-22-9-3-1-4-10-22/h1-7,9-12,14-15,21H,8,13,16-20H2,(H,28,29) |
| InChIKey | ZQZANRQZCRAIFR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|