C23H22N2O5 — CID 26169071
2-phenylethyl 4-[3-(furan-2-carbonylamino)anilino]-4-oxobutanoate (PubChem CID 26169071) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-phenylethyl 4-[3-(furan-2-carbonylamino)anilino]-4-oxobutanoate.
| Compound Name | 2-phenylethyl 4-[3-(furan-2-carbonylamino)anilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 26169071 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-phenylethyl 4-[3-(furan-2-carbonylamino)anilino]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCCc1ccccc1)Nc1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C23H22N2O5/c26-21(11-12-22(27)30-15-13-17-6-2-1-3-7-17)24-18-8-4-9-19(16-18)25-23(28)20-10-5-14-29-20/h1-10,14,16H,11-13,15H2,(H,24,26)(H,25,28) |
| InChIKey | DOSVAYBPSWQHBJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |