C24H23N3O5S — CID 26169286
2-phenylethyl 4-[[3-(furan-2-carbonylamino)phenyl]carbamothioylamino]-4-oxobutanoate (PubChem CID 26169286) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is 2-phenylethyl 4-[[3-(furan-2-carbonylamino)phenyl]carbamothioylamino]-4-oxobutanoate.
| Compound Name | 2-phenylethyl 4-[[3-(furan-2-carbonylamino)phenyl]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 26169286 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 2-phenylethyl 4-[[3-(furan-2-carbonylamino)phenyl]carbamothioylamino]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCCc1ccccc1)NC(=S)Nc1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C24H23N3O5S/c28-21(11-12-22(29)32-15-13-17-6-2-1-3-7-17)27-24(33)26-19-9-4-8-18(16-19)25-23(30)20-10-5-14-31-20/h1-10,14,16H,11-13,15H2,(H,25,30)(H2,26,27,28,33) |
| InChIKey | HMIGJFZNKSSREM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|