C23H28N2O4S — CID 17154880
3-phenylpropyl 4-oxo-4-[(3-propan-2-yloxyphenyl)carbamothioylamino]butanoate (PubChem CID 17154880) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is 3-phenylpropyl 4-oxo-4-[(3-propan-2-yloxyphenyl)carbamothioylamino]butanoate.
| Compound Name | 3-phenylpropyl 4-oxo-4-[(3-propan-2-yloxyphenyl)carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 17154880 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 3-phenylpropyl 4-oxo-4-[(3-propan-2-yloxyphenyl)carbamothioylamino]butanoate |
| SMILES | CC(C)Oc1cccc(NC(=S)NC(=O)CCC(=O)OCCCc2ccccc2)c1 |
| InChI | InChI=1S/C23H28N2O4S/c1-17(2)29-20-12-6-11-19(16-20)24-23(30)25-21(26)13-14-22(27)28-15-7-10-18-8-4-3-5-9-18/h3-6,8-9,11-12,16-17H,7,10,13-15H2,1-2H3,(H2,24,25,26,30) |
| InChIKey | MLGNORCAJUUTNU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|