C22H26N2O5S — CID 17067153
2-methoxyethyl 4-oxo-4-[[4-(2-phenylethoxy)phenyl]carbamothioylamino]butanoate (PubChem CID 17067153) has the molecular formula C22H26N2O5S and a molecular weight of 430.53 g/mol. Its IUPAC name is 2-methoxyethyl 4-oxo-4-[[4-(2-phenylethoxy)phenyl]carbamothioylamino]butanoate.
| Compound Name | 2-methoxyethyl 4-oxo-4-[[4-(2-phenylethoxy)phenyl]carbamothioylamino]butanoate |
|---|---|
| PubChem CID | 17067153 |
| Molecular Formula | C22H26N2O5S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2-methoxyethyl 4-oxo-4-[[4-(2-phenylethoxy)phenyl]carbamothioylamino]butanoate |
| SMILES | COCCOC(=O)CCC(=O)NC(=S)Nc1ccc(OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H26N2O5S/c1-27-15-16-29-21(26)12-11-20(25)24-22(30)23-18-7-9-19(10-8-18)28-14-13-17-5-3-2-4-6-17/h2-10H,11-16H2,1H3,(H2,23,24,25,30) |
| InChIKey | KWJWPAODBXARIG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|