C19H18ClN3O5S — CID 4947175
2-phenylethyl 4-[(4-chloro-3-nitrophenyl)carbamothioylamino]-4-oxobutanoate (PubChem CID 4947175) has the molecular formula C19H18ClN3O5S and a molecular weight of 435.89 g/mol. Its IUPAC name is 2-phenylethyl 4-[(4-chloro-3-nitrophenyl)carbamothioylamino]-4-oxobutanoate.
| Compound Name | 2-phenylethyl 4-[(4-chloro-3-nitrophenyl)carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4947175 |
| Molecular Formula | C19H18ClN3O5S |
| Molecular Weight | 435.89 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 2-phenylethyl 4-[(4-chloro-3-nitrophenyl)carbamothioylamino]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCCc1ccccc1)NC(=S)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18ClN3O5S/c20-15-7-6-14(12-16(15)23(26)27)21-19(29)22-17(24)8-9-18(25)28-11-10-13-4-2-1-3-5-13/h1-7,12H,8-11H2,(H2,21,22,24,29) |
| InChIKey | QEXMPYUXGRNKAP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.89 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|