C19H18Cl2N2O3S — CID 4947329
2-phenylethyl 4-[(2,5-dichlorophenyl)carbamothioylamino]-4-oxobutanoate (PubChem CID 4947329) has the molecular formula C19H18Cl2N2O3S and a molecular weight of 425.34 g/mol. Its IUPAC name is 2-phenylethyl 4-[(2,5-dichlorophenyl)carbamothioylamino]-4-oxobutanoate.
| Compound Name | 2-phenylethyl 4-[(2,5-dichlorophenyl)carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4947329 |
| Molecular Formula | C19H18Cl2N2O3S |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 2-phenylethyl 4-[(2,5-dichlorophenyl)carbamothioylamino]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCCc1ccccc1)NC(=S)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C19H18Cl2N2O3S/c20-14-6-7-15(21)16(12-14)22-19(27)23-17(24)8-9-18(25)26-11-10-13-4-2-1-3-5-13/h1-7,12H,8-11H2,(H2,22,23,24,27) |
| InChIKey | IWVICIQCLASOHB-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|