C18H17Cl2NO3 — CID 4946830
2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate (PubChem CID 4946830) has the molecular formula C18H17Cl2NO3 and a molecular weight of 366.24 g/mol. Its IUPAC name is 2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate.
| Compound Name | 2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 4946830 |
| Molecular Formula | C18H17Cl2NO3 |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCCc1ccccc1)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H17Cl2NO3/c19-14-6-7-15(20)16(12-14)21-17(22)8-9-18(23)24-11-10-13-4-2-1-3-5-13/h1-7,12H,8-11H2,(H,21,22) |
| InChIKey | PZXZELGLVGKBJH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |