2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate

C18H17Cl2NO3 — CID 4946830

IUPAC2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate
SMILESO=C(CCC(=O)OCCc1ccccc1)Nc1cc(Cl)ccc1Cl
InChIInChI=1S/C18H17Cl2NO3/c19-14-6-7-15(20)16(12-14)21-17(22)8-9-18(23)24-11-10-13-4-2-1-3-5-13/h1-7,12H,8-11H2,(H,21,22)
InChIKeyPZXZELGLVGKBJH-UHFFFAOYSA-N
MW366.24 g/mol
LogP4.50
Rot. Bonds7

About 2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate

2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate (PubChem CID 4946830) has the molecular formula C18H17Cl2NO3 and a molecular weight of 366.24 g/mol. Its IUPAC name is 2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate.

Molecular Properties

Compound Name2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate
PubChem CID4946830
Molecular FormulaC18H17Cl2NO3
Molecular Weight366.24 g/mol
Exact Mass365.06
IUPAC Name2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate
SMILESO=C(CCC(=O)OCCc1ccccc1)Nc1cc(Cl)ccc1Cl
InChIInChI=1S/C18H17Cl2NO3/c19-14-6-7-15(20)16(12-14)21-17(22)8-9-18(23)24-11-10-13-4-2-1-3-5-13/h1-7,12H,8-11H2,(H,21,22)
InChIKeyPZXZELGLVGKBJH-UHFFFAOYSA-N
XLogP4.50
TPSA55.40 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500366.24
LogP ≤ 54.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate?
The IUPAC name of 2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate (CID 4946830) is 2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate.
What is the SMILES notation for 2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate?
The canonical SMILES for 2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate is O=C(CCC(=O)OCCc1ccccc1)Nc1cc(Cl)ccc1Cl.
What is the InChIKey of 2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate?
The InChIKey is PZXZELGLVGKBJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2NO3/c19-14-6-7-15(20)16(12-14)21-17(22)8-9-18(23)24-11-10-13-4-2-1-3-5-13/h1-7,12H,8-11H2,(H,21,22).
What are the key properties of 2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate?
2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate has a molecular weight of 366.24 g/mol, XLogP of 4.50, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl 4-(2,5-dichloroanilino)-4-oxobutanoate is sourced from PubChem (CID 4946830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).