C13H13Cl2NO4 — CID 8625714
[2-(2,5-dichloroanilino)-2-oxoethyl] 4-oxopentanoate (PubChem CID 8625714) has the molecular formula C13H13Cl2NO4 and a molecular weight of 318.16 g/mol. Its IUPAC name is [2-(2,5-dichloroanilino)-2-oxoethyl] 4-oxopentanoate.
| Compound Name | [2-(2,5-dichloroanilino)-2-oxoethyl] 4-oxopentanoate |
|---|---|
| PubChem CID | 8625714 |
| Molecular Formula | C13H13Cl2NO4 |
| Molecular Weight | 318.16 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | [2-(2,5-dichloroanilino)-2-oxoethyl] 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)OCC(=O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H13Cl2NO4/c1-8(17)2-5-13(19)20-7-12(18)16-11-6-9(14)3-4-10(11)15/h3-4,6H,2,5,7H2,1H3,(H,16,18) |
| InChIKey | LKOQMOOAHSJVBA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.16 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |