C14H16ClNO5 — CID 8627342
[2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 4-oxopentanoate (PubChem CID 8627342) has the molecular formula C14H16ClNO5 and a molecular weight of 313.74 g/mol. Its IUPAC name is [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 4-oxopentanoate.
| Compound Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 4-oxopentanoate |
|---|---|
| PubChem CID | 8627342 |
| Molecular Formula | C14H16ClNO5 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 4-oxopentanoate |
| SMILES | COc1ccc(Cl)cc1NC(=O)COC(=O)CCC(C)=O |
| InChI | InChI=1S/C14H16ClNO5/c1-9(17)3-6-14(19)21-8-13(18)16-11-7-10(15)4-5-12(11)20-2/h4-5,7H,3,6,8H2,1-2H3,(H,16,18) |
| InChIKey | BOMRDUUFENBQFE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |