C19H21ClN2O6S — CID 2602596
[2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 3-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 2602596) has the molecular formula C19H21ClN2O6S and a molecular weight of 440.91 g/mol. Its IUPAC name is [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 3-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 3-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 2602596 |
| Molecular Formula | C19H21ClN2O6S |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl] 3-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | COc1ccc(Cl)cc1NC(=O)COC(=O)CCNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H21ClN2O6S/c1-13-3-6-15(7-4-13)29(25,26)21-10-9-19(24)28-12-18(23)22-16-11-14(20)5-8-17(16)27-2/h3-8,11,21H,9-10,12H2,1-2H3,(H,22,23) |
| InChIKey | MJVAMPFUQNYCIG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |