C20H26ClN3O6S2 — CID 17225707
3-[(4-chlorophenyl)sulfonylamino]-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]propanamide (PubChem CID 17225707) has the molecular formula C20H26ClN3O6S2 and a molecular weight of 504.03 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfonylamino]-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]propanamide.
| Compound Name | 3-[(4-chlorophenyl)sulfonylamino]-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]propanamide |
|---|---|
| PubChem CID | 17225707 |
| Molecular Formula | C20H26ClN3O6S2 |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfonylamino]-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)CCNS(=O)(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H26ClN3O6S2/c1-4-24(5-2)32(28,29)17-10-11-19(30-3)18(14-17)23-20(25)12-13-22-31(26,27)16-8-6-15(21)7-9-16/h6-11,14,22H,4-5,12-13H2,1-3H3,(H,23,25) |
| InChIKey | VMFIMPBTFQSCDA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |