C22H28ClN3O5S2 — CID 19188919
4-(4-chlorophenoxy)-N-[[5-(diethylsulfamoyl)-2-methoxyphenyl]carbamothioyl]butanamide (PubChem CID 19188919) has the molecular formula C22H28ClN3O5S2 and a molecular weight of 514.07 g/mol. Its IUPAC name is 4-(4-chlorophenoxy)-N-[[5-(diethylsulfamoyl)-2-methoxyphenyl]carbamothioyl]butanamide.
| Compound Name | 4-(4-chlorophenoxy)-N-[[5-(diethylsulfamoyl)-2-methoxyphenyl]carbamothioyl]butanamide |
|---|---|
| PubChem CID | 19188919 |
| Molecular Formula | C22H28ClN3O5S2 |
| Molecular Weight | 514.07 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 4-(4-chlorophenoxy)-N-[[5-(diethylsulfamoyl)-2-methoxyphenyl]carbamothioyl]butanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(NC(=S)NC(=O)CCCOc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H28ClN3O5S2/c1-4-26(5-2)33(28,29)18-12-13-20(30-3)19(15-18)24-22(32)25-21(27)7-6-14-31-17-10-8-16(23)9-11-17/h8-13,15H,4-7,14H2,1-3H3,(H2,24,25,27,32) |
| InChIKey | IQMBWNRYGYZJEC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.07 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|