C23H30N2O4S — CID 19188688
4-(4-tert-butylphenoxy)-N-[(2,5-dimethoxyphenyl)carbamothioyl]butanamide (PubChem CID 19188688) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-N-[(2,5-dimethoxyphenyl)carbamothioyl]butanamide.
| Compound Name | 4-(4-tert-butylphenoxy)-N-[(2,5-dimethoxyphenyl)carbamothioyl]butanamide |
|---|---|
| PubChem CID | 19188688 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-N-[(2,5-dimethoxyphenyl)carbamothioyl]butanamide |
| SMILES | COc1ccc(OC)c(NC(=S)NC(=O)CCCOc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C23H30N2O4S/c1-23(2,3)16-8-10-17(11-9-16)29-14-6-7-21(26)25-22(30)24-19-15-18(27-4)12-13-20(19)28-5/h8-13,15H,6-7,14H2,1-5H3,(H2,24,25,26,30) |
| InChIKey | ODAVGVLXSJTNEW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|