C21H24Cl2N2O2S — CID 19188720
4-(4-tert-butylphenoxy)-N-[(3,4-dichlorophenyl)carbamothioyl]butanamide (PubChem CID 19188720) has the molecular formula C21H24Cl2N2O2S and a molecular weight of 439.41 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-N-[(3,4-dichlorophenyl)carbamothioyl]butanamide.
| Compound Name | 4-(4-tert-butylphenoxy)-N-[(3,4-dichlorophenyl)carbamothioyl]butanamide |
|---|---|
| PubChem CID | 19188720 |
| Molecular Formula | C21H24Cl2N2O2S |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-N-[(3,4-dichlorophenyl)carbamothioyl]butanamide |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)NC(=S)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H24Cl2N2O2S/c1-21(2,3)14-6-9-16(10-7-14)27-12-4-5-19(26)25-20(28)24-15-8-11-17(22)18(23)13-15/h6-11,13H,4-5,12H2,1-3H3,(H2,24,25,26,28) |
| InChIKey | XPFSSVLIFYJSML-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|