C15H11BrCl2N2O2S — CID 3342562
2-(4-bromophenoxy)-N-[(3,4-dichlorophenyl)carbamothioyl]acetamide (PubChem CID 3342562) has the molecular formula C15H11BrCl2N2O2S and a molecular weight of 434.14 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-[(3,4-dichlorophenyl)carbamothioyl]acetamide.
| Compound Name | 2-(4-bromophenoxy)-N-[(3,4-dichlorophenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3342562 |
| Molecular Formula | C15H11BrCl2N2O2S |
| Molecular Weight | 434.14 g/mol |
| Exact Mass | 431.91 |
| IUPAC Name | 2-(4-bromophenoxy)-N-[(3,4-dichlorophenyl)carbamothioyl]acetamide |
| SMILES | O=C(COc1ccc(Br)cc1)NC(=S)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11BrCl2N2O2S/c16-9-1-4-11(5-2-9)22-8-14(21)20-15(23)19-10-3-6-12(17)13(18)7-10/h1-7H,8H2,(H2,19,20,21,23) |
| InChIKey | WIDLACBLCRUTKD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.14 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|