C16H12BrN3O2S — CID 3340919
2-(4-bromophenoxy)-N-[(4-cyanophenyl)carbamothioyl]acetamide (PubChem CID 3340919) has the molecular formula C16H12BrN3O2S and a molecular weight of 390.26 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-[(4-cyanophenyl)carbamothioyl]acetamide.
| Compound Name | 2-(4-bromophenoxy)-N-[(4-cyanophenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3340919 |
| Molecular Formula | C16H12BrN3O2S |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | 2-(4-bromophenoxy)-N-[(4-cyanophenyl)carbamothioyl]acetamide |
| SMILES | N#Cc1ccc(NC(=S)NC(=O)COc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C16H12BrN3O2S/c17-12-3-7-14(8-4-12)22-10-15(21)20-16(23)19-13-5-1-11(9-18)2-6-13/h1-8H,10H2,(H2,19,20,21,23) |
| InChIKey | NMYRFDMJCFBDLA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|