C19H22BrN3O4S2 — CID 3346128
2-(4-bromophenoxy)-N-[[4-(diethylsulfamoyl)phenyl]carbamothioyl]acetamide (PubChem CID 3346128) has the molecular formula C19H22BrN3O4S2 and a molecular weight of 500.44 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-[[4-(diethylsulfamoyl)phenyl]carbamothioyl]acetamide.
| Compound Name | 2-(4-bromophenoxy)-N-[[4-(diethylsulfamoyl)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3346128 |
| Molecular Formula | C19H22BrN3O4S2 |
| Molecular Weight | 500.44 g/mol |
| Exact Mass | 499.02 |
| IUPAC Name | 2-(4-bromophenoxy)-N-[[4-(diethylsulfamoyl)phenyl]carbamothioyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=S)NC(=O)COc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C19H22BrN3O4S2/c1-3-23(4-2)29(25,26)17-11-7-15(8-12-17)21-19(28)22-18(24)13-27-16-9-5-14(20)6-10-16/h5-12H,3-4,13H2,1-2H3,(H2,21,22,24,28) |
| InChIKey | HGILOCWWNLCQDI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|