C18H20BrN3O3S2 — CID 54791626
3-bromo-N-[[4-(diethylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 54791626) has the molecular formula C18H20BrN3O3S2 and a molecular weight of 470.41 g/mol. Its IUPAC name is 3-bromo-N-[[4-(diethylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-N-[[4-(diethylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 54791626 |
| Molecular Formula | C18H20BrN3O3S2 |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 469.01 |
| IUPAC Name | 3-bromo-N-[[4-(diethylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=S)NC(=O)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C18H20BrN3O3S2/c1-3-22(4-2)27(24,25)16-10-8-15(9-11-16)20-18(26)21-17(23)13-6-5-7-14(19)12-13/h5-12H,3-4H2,1-2H3,(H2,20,21,23,26) |
| InChIKey | FJMCDIBWTCRNJC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|