C21H27N3O6S2 — CID 5178536
N-[[4-(diethylsulfamoyl)phenyl]carbamothioyl]-3,4,5-trimethoxybenzamide (PubChem CID 5178536) has the molecular formula C21H27N3O6S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is N-[[4-(diethylsulfamoyl)phenyl]carbamothioyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[[4-(diethylsulfamoyl)phenyl]carbamothioyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 5178536 |
| Molecular Formula | C21H27N3O6S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | N-[[4-(diethylsulfamoyl)phenyl]carbamothioyl]-3,4,5-trimethoxybenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=S)NC(=O)c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C21H27N3O6S2/c1-6-24(7-2)32(26,27)16-10-8-15(9-11-16)22-21(31)23-20(25)14-12-17(28-3)19(30-5)18(13-14)29-4/h8-13H,6-7H2,1-5H3,(H2,22,23,25,31) |
| InChIKey | CHIFIQCGFRUIKX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|