C21H28N2O7S — CID 2913924
N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-3,4,5-trimethoxybenzamide (PubChem CID 2913924) has the molecular formula C21H28N2O7S and a molecular weight of 452.53 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 2913924 |
| Molecular Formula | C21H28N2O7S |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-3,4,5-trimethoxybenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)c2cc(OC)c(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C21H28N2O7S/c1-7-23(8-2)31(25,26)15-9-10-17(27-3)16(13-15)22-21(24)14-11-18(28-4)20(30-6)19(12-14)29-5/h9-13H,7-8H2,1-6H3,(H,22,24) |
| InChIKey | HADUCXGOWICLDE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |