C22H31N3O6S2 — CID 4003550
3-(diethylsulfamoyl)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]benzamide (PubChem CID 4003550) has the molecular formula C22H31N3O6S2 and a molecular weight of 497.64 g/mol. Its IUPAC name is 3-(diethylsulfamoyl)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]benzamide.
| Compound Name | 3-(diethylsulfamoyl)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]benzamide |
|---|---|
| PubChem CID | 4003550 |
| Molecular Formula | C22H31N3O6S2 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 3-(diethylsulfamoyl)-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)Nc2cc(S(=O)(=O)N(CC)CC)ccc2OC)c1 |
| InChI | InChI=1S/C22H31N3O6S2/c1-6-24(7-2)32(27,28)18-12-10-11-17(15-18)22(26)23-20-16-19(13-14-21(20)31-5)33(29,30)25(8-3)9-4/h10-16H,6-9H2,1-5H3,(H,23,26) |
| InChIKey | GEVHIOOVHOPZRZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |