C17H20ClN3O4S — CID 8011851
6-chloro-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]pyridine-3-carboxamide (PubChem CID 8011851) has the molecular formula C17H20ClN3O4S and a molecular weight of 397.88 g/mol. Its IUPAC name is 6-chloro-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 8011851 |
| Molecular Formula | C17H20ClN3O4S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 6-chloro-N-[5-(diethylsulfamoyl)-2-methoxyphenyl]pyridine-3-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)c2ccc(Cl)nc2)c1 |
| InChI | InChI=1S/C17H20ClN3O4S/c1-4-21(5-2)26(23,24)13-7-8-15(25-3)14(10-13)20-17(22)12-6-9-16(18)19-11-12/h6-11H,4-5H2,1-3H3,(H,20,22) |
| InChIKey | TVYMXHMYOVFDCZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|