C18H21Cl2N3O4S — CID 2963637
1-(3,4-dichlorophenyl)-3-[5-(diethylsulfamoyl)-2-methoxyphenyl]urea (PubChem CID 2963637) has the molecular formula C18H21Cl2N3O4S and a molecular weight of 446.36 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[5-(diethylsulfamoyl)-2-methoxyphenyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[5-(diethylsulfamoyl)-2-methoxyphenyl]urea |
|---|---|
| PubChem CID | 2963637 |
| Molecular Formula | C18H21Cl2N3O4S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[5-(diethylsulfamoyl)-2-methoxyphenyl]urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)Nc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H21Cl2N3O4S/c1-4-23(5-2)28(25,26)13-7-9-17(27-3)16(11-13)22-18(24)21-12-6-8-14(19)15(20)10-12/h6-11H,4-5H2,1-3H3,(H2,21,22,24) |
| InChIKey | JHKQPVBDHUNJJY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |