C19H24Cl2N4O3S — CID 4839383
1-(3,4-dichlorophenyl)-3-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]urea (PubChem CID 4839383) has the molecular formula C19H24Cl2N4O3S and a molecular weight of 459.40 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]urea |
|---|---|
| PubChem CID | 4839383 |
| Molecular Formula | C19H24Cl2N4O3S |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]urea |
| SMILES | CCNc1ccc(S(=O)(=O)N(CC)CC)cc1NC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H24Cl2N4O3S/c1-4-22-17-10-8-14(29(27,28)25(5-2)6-3)12-18(17)24-19(26)23-13-7-9-15(20)16(21)11-13/h7-12,22H,4-6H2,1-3H3,(H2,23,24,26) |
| InChIKey | NZTUHVWSLRCHKM-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |