C17H30N4O3S — CID 119680561
N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]-4-(methylamino)butanamide (PubChem CID 119680561) has the molecular formula C17H30N4O3S and a molecular weight of 370.52 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]-4-(methylamino)butanamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119680561 |
| Molecular Formula | C17H30N4O3S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]-4-(methylamino)butanamide |
| SMILES | CCNc1ccc(S(=O)(=O)N(CC)CC)cc1NC(=O)CCCNC |
| InChI | InChI=1S/C17H30N4O3S/c1-5-19-15-11-10-14(25(23,24)21(6-2)7-3)13-16(15)20-17(22)9-8-12-18-4/h10-11,13,18-19H,5-9,12H2,1-4H3,(H,20,22) |
| InChIKey | KCHKMVASOVSATP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|