C16H29ClN4O3S — CID 119685367
N-[5-(diethylsulfamoyl)-2-(propylamino)phenyl]-2-(methylamino)acetamide;hydrochloride (PubChem CID 119685367) has the molecular formula C16H29ClN4O3S and a molecular weight of 392.95 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-(propylamino)phenyl]-2-(methylamino)acetamide;hydrochloride.
| Compound Name | N-[5-(diethylsulfamoyl)-2-(propylamino)phenyl]-2-(methylamino)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119685367 |
| Molecular Formula | C16H29ClN4O3S |
| Molecular Weight | 392.95 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-(propylamino)phenyl]-2-(methylamino)acetamide;hydrochloride |
| SMILES | CCCNc1ccc(S(=O)(=O)N(CC)CC)cc1NC(=O)CNC.Cl |
| InChI | InChI=1S/C16H28N4O3S.ClH/c1-5-10-18-14-9-8-13(24(22,23)20(6-2)7-3)11-15(14)19-16(21)12-17-4;/h8-9,11,17-18H,5-7,10,12H2,1-4H3,(H,19,21);1H |
| InChIKey | FQUJWPJMBMUIAN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.95 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |