C18H31N3O3S — CID 78848200
N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]-4-methylpentanamide (PubChem CID 78848200) has the molecular formula C18H31N3O3S and a molecular weight of 369.53 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]-4-methylpentanamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 78848200 |
| Molecular Formula | C18H31N3O3S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]-4-methylpentanamide |
| SMILES | CCNc1ccc(S(=O)(=O)N(CC)CC)cc1NC(=O)CCC(C)C |
| InChI | InChI=1S/C18H31N3O3S/c1-6-19-16-11-10-15(25(23,24)21(7-2)8-3)13-17(16)20-18(22)12-9-14(4)5/h10-11,13-14,19H,6-9,12H2,1-5H3,(H,20,22) |
| InChIKey | PNSGWUFLKPXENK-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |