C17H31ClN4O3S — CID 120558969
4-amino-N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]pentanamide;hydrochloride (PubChem CID 120558969) has the molecular formula C17H31ClN4O3S and a molecular weight of 406.98 g/mol. Its IUPAC name is 4-amino-N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]pentanamide;hydrochloride.
| Compound Name | 4-amino-N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 120558969 |
| Molecular Formula | C17H31ClN4O3S |
| Molecular Weight | 406.98 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 4-amino-N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]pentanamide;hydrochloride |
| SMILES | CCNc1ccc(S(=O)(=O)N(CC)CC)cc1NC(=O)CCC(C)N.Cl |
| InChI | InChI=1S/C17H30N4O3S.ClH/c1-5-19-15-10-9-14(25(23,24)21(6-2)7-3)12-16(15)20-17(22)11-8-13(4)18;/h9-10,12-13,19H,5-8,11,18H2,1-4H3,(H,20,22);1H |
| InChIKey | VBGWRDVVIYJDCO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.98 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |