C23H30N4O3S — CID 78852611
N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]-2-(2-methyl-1H-indol-3-yl)acetamide (PubChem CID 78852611) has the molecular formula C23H30N4O3S and a molecular weight of 442.59 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]-2-(2-methyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]-2-(2-methyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 78852611 |
| Molecular Formula | C23H30N4O3S |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-(ethylamino)phenyl]-2-(2-methyl-1H-indol-3-yl)acetamide |
| SMILES | CCNc1ccc(S(=O)(=O)N(CC)CC)cc1NC(=O)Cc1c(C)[nH]c2ccccc12 |
| InChI | InChI=1S/C23H30N4O3S/c1-5-24-21-13-12-17(31(29,30)27(6-2)7-3)14-22(21)26-23(28)15-19-16(4)25-20-11-9-8-10-18(19)20/h8-14,24-25H,5-7,15H2,1-4H3,(H,26,28) |
| InChIKey | WNVQFEPCCBMJEQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|