C17H13F3N2O — CID 113211384
2-(2-methyl-1H-indol-3-yl)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 113211384) has the molecular formula C17H13F3N2O and a molecular weight of 318.30 g/mol. Its IUPAC name is 2-(2-methyl-1H-indol-3-yl)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(2-methyl-1H-indol-3-yl)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 113211384 |
| Molecular Formula | C17H13F3N2O |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-(2-methyl-1H-indol-3-yl)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | Cc1[nH]c2ccccc2c1CC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H13F3N2O/c1-9-11(10-4-2-3-5-13(10)21-9)8-15(23)22-14-7-6-12(18)16(19)17(14)20/h2-7,21H,8H2,1H3,(H,22,23) |
| InChIKey | IYSDWTXIRHWHNL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|