C18H14ClF3N2O — CID 113212039
2-(5-chloro-2-methyl-1H-indol-3-yl)-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 113212039) has the molecular formula C18H14ClF3N2O and a molecular weight of 366.77 g/mol. Its IUPAC name is 2-(5-chloro-2-methyl-1H-indol-3-yl)-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(5-chloro-2-methyl-1H-indol-3-yl)-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 113212039 |
| Molecular Formula | C18H14ClF3N2O |
| Molecular Weight | 366.77 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 2-(5-chloro-2-methyl-1H-indol-3-yl)-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1[nH]c2ccc(Cl)cc2c1CC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H14ClF3N2O/c1-10-12(13-8-11(19)6-7-15(13)23-10)9-17(25)24-16-5-3-2-4-14(16)18(20,21)22/h2-8,23H,9H2,1H3,(H,24,25) |
| InChIKey | WHLBTLUGLXCZKR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.77 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|