C19H16ClF3N2O2 — CID 113212246
N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide (PubChem CID 113212246) has the molecular formula C19H16ClF3N2O2 and a molecular weight of 396.80 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 113212246 |
| Molecular Formula | C19H16ClF3N2O2 |
| Molecular Weight | 396.80 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(5-methoxy-2-methyl-1H-indol-3-yl)acetamide |
| SMILES | COc1ccc2[nH]c(C)c(CC(=O)Nc3ccc(Cl)cc3C(F)(F)F)c2c1 |
| InChI | InChI=1S/C19H16ClF3N2O2/c1-10-13(14-8-12(27-2)4-6-16(14)24-10)9-18(26)25-17-5-3-11(20)7-15(17)19(21,22)23/h3-8,24H,9H2,1-2H3,(H,25,26) |
| InChIKey | FHAIABHRPJLFFN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.80 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|