C16H14ClF3N2O3 — CID 108992212
1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(2,4-dimethoxyphenyl)urea (PubChem CID 108992212) has the molecular formula C16H14ClF3N2O3 and a molecular weight of 374.75 g/mol. Its IUPAC name is 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(2,4-dimethoxyphenyl)urea.
| Compound Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(2,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 108992212 |
| Molecular Formula | C16H14ClF3N2O3 |
| Molecular Weight | 374.75 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(2,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)Nc2ccc(Cl)cc2C(F)(F)F)c(OC)c1 |
| InChI | InChI=1S/C16H14ClF3N2O3/c1-24-10-4-6-13(14(8-10)25-2)22-15(23)21-12-5-3-9(17)7-11(12)16(18,19)20/h3-8H,1-2H3,(H2,21,22,23) |
| InChIKey | ATRHIGJMEMNHBA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.75 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |