C16H13ClF3NO3 — CID 18892483
N-[4-chloro-2-(trifluoromethyl)phenyl]-2,6-dimethoxybenzamide (PubChem CID 18892483) has the molecular formula C16H13ClF3NO3 and a molecular weight of 359.73 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2,6-dimethoxybenzamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2,6-dimethoxybenzamide |
|---|---|
| PubChem CID | 18892483 |
| Molecular Formula | C16H13ClF3NO3 |
| Molecular Weight | 359.73 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2,6-dimethoxybenzamide |
| SMILES | COc1cccc(OC)c1C(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C16H13ClF3NO3/c1-23-12-4-3-5-13(24-2)14(12)15(22)21-11-7-6-9(17)8-10(11)16(18,19)20/h3-8H,1-2H3,(H,21,22) |
| InChIKey | QLCNIVUNGXVPBA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.73 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |