C14H7Cl3F3NO — CID 2296110
2,3-dichloro-N-[4-chloro-2-(trifluoromethyl)phenyl]benzamide (PubChem CID 2296110) has the molecular formula C14H7Cl3F3NO and a molecular weight of 368.57 g/mol. Its IUPAC name is 2,3-dichloro-N-[4-chloro-2-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2,3-dichloro-N-[4-chloro-2-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2296110 |
| Molecular Formula | C14H7Cl3F3NO |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 366.95 |
| IUPAC Name | 2,3-dichloro-N-[4-chloro-2-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(F)(F)F)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H7Cl3F3NO/c15-7-4-5-11(9(6-7)14(18,19)20)21-13(22)8-2-1-3-10(16)12(8)17/h1-6H,(H,21,22) |
| InChIKey | ZJFCBRQVVSQPPI-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |