C14H9ClF3NO — CID 801878
N-[4-chloro-2-(trifluoromethyl)phenyl]benzamide (PubChem CID 801878) has the molecular formula C14H9ClF3NO and a molecular weight of 299.68 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 801878 |
| Molecular Formula | C14H9ClF3NO |
| Molecular Weight | 299.68 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H9ClF3NO/c15-10-6-7-12(11(8-10)14(16,17)18)19-13(20)9-4-2-1-3-5-9/h1-8H,(H,19,20) |
| InChIKey | IOCMCZNZGLYDMF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.68 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |