C19H18ClF3N2O2 — CID 109051222
1-N-butyl-3-N-[4-chloro-2-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide (PubChem CID 109051222) has the molecular formula C19H18ClF3N2O2 and a molecular weight of 398.81 g/mol. Its IUPAC name is 1-N-butyl-3-N-[4-chloro-2-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N-butyl-3-N-[4-chloro-2-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109051222 |
| Molecular Formula | C19H18ClF3N2O2 |
| Molecular Weight | 398.81 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 1-N-butyl-3-N-[4-chloro-2-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)c1cccc(C(=O)Nc2ccc(Cl)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18ClF3N2O2/c1-2-3-9-24-17(26)12-5-4-6-13(10-12)18(27)25-16-8-7-14(20)11-15(16)19(21,22)23/h4-8,10-11H,2-3,9H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | RQBQOLAOKLZMCM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.81 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|