C19H21ClN2O2 — CID 109051168
1-N-butyl-3-N-(4-chloro-2-methylphenyl)benzene-1,3-dicarboxamide (PubChem CID 109051168) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is 1-N-butyl-3-N-(4-chloro-2-methylphenyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N-butyl-3-N-(4-chloro-2-methylphenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109051168 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-N-butyl-3-N-(4-chloro-2-methylphenyl)benzene-1,3-dicarboxamide |
| SMILES | CCCCNC(=O)c1cccc(C(=O)Nc2ccc(Cl)cc2C)c1 |
| InChI | InChI=1S/C19H21ClN2O2/c1-3-4-10-21-18(23)14-6-5-7-15(12-14)19(24)22-17-9-8-16(20)11-13(17)2/h5-9,11-12H,3-4,10H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | RLKOLDONQIAXRV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|