C21H14Cl2F3NO2 — CID 19916448
4-[(2-chlorophenyl)methoxy]-N-[4-chloro-2-(trifluoromethyl)phenyl]benzamide (PubChem CID 19916448) has the molecular formula C21H14Cl2F3NO2 and a molecular weight of 440.25 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methoxy]-N-[4-chloro-2-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-[(2-chlorophenyl)methoxy]-N-[4-chloro-2-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 19916448 |
| Molecular Formula | C21H14Cl2F3NO2 |
| Molecular Weight | 440.25 g/mol |
| Exact Mass | 439.04 |
| IUPAC Name | 4-[(2-chlorophenyl)methoxy]-N-[4-chloro-2-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(F)(F)F)c1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C21H14Cl2F3NO2/c22-15-7-10-19(17(11-15)21(24,25)26)27-20(28)13-5-8-16(9-6-13)29-12-14-3-1-2-4-18(14)23/h1-11H,12H2,(H,27,28) |
| InChIKey | NHVKJDMBOZBFLH-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.25 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |