C16H13Cl2F3N2O — CID 108900378
1-[2-(2-chlorophenyl)ethyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]urea (PubChem CID 108900378) has the molecular formula C16H13Cl2F3N2O and a molecular weight of 377.19 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)ethyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-(2-chlorophenyl)ethyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 108900378 |
| Molecular Formula | C16H13Cl2F3N2O |
| Molecular Weight | 377.19 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 1-[2-(2-chlorophenyl)ethyl]-3-[4-chloro-2-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCCc1ccccc1Cl)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C16H13Cl2F3N2O/c17-11-5-6-14(12(9-11)16(19,20)21)23-15(24)22-8-7-10-3-1-2-4-13(10)18/h1-6,9H,7-8H2,(H2,22,23,24) |
| InChIKey | SGPKYWYPZQYJBV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.19 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |