C13H16ClF3N2O — CID 47325404
1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(3-methylbutyl)urea (PubChem CID 47325404) has the molecular formula C13H16ClF3N2O and a molecular weight of 308.73 g/mol. Its IUPAC name is 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(3-methylbutyl)urea.
| Compound Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(3-methylbutyl)urea |
|---|---|
| PubChem CID | 47325404 |
| Molecular Formula | C13H16ClF3N2O |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(3-methylbutyl)urea |
| SMILES | CC(C)CCNC(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C13H16ClF3N2O/c1-8(2)5-6-18-12(20)19-11-4-3-9(14)7-10(11)13(15,16)17/h3-4,7-8H,5-6H2,1-2H3,(H2,18,19,20) |
| InChIKey | JGDXZFFRQWANDD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |