C12H15ClF3N3O3S — CID 118765522
1-[4-chloro-2-(trifluoromethyl)phenyl]-3-[2-(dimethylsulfamoyl)ethyl]urea (PubChem CID 118765522) has the molecular formula C12H15ClF3N3O3S and a molecular weight of 373.78 g/mol. Its IUPAC name is 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-[2-(dimethylsulfamoyl)ethyl]urea.
| Compound Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-[2-(dimethylsulfamoyl)ethyl]urea |
|---|---|
| PubChem CID | 118765522 |
| Molecular Formula | C12H15ClF3N3O3S |
| Molecular Weight | 373.78 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-[2-(dimethylsulfamoyl)ethyl]urea |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C12H15ClF3N3O3S/c1-19(2)23(21,22)6-5-17-11(20)18-10-4-3-8(13)7-9(10)12(14,15)16/h3-4,7H,5-6H2,1-2H3,(H2,17,18,20) |
| InChIKey | QVEZIIWVCANHQA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.78 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |