C12H12ClF3N2O — CID 3867881
1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(cyclopropylmethyl)urea (PubChem CID 3867881) has the molecular formula C12H12ClF3N2O and a molecular weight of 292.69 g/mol. Its IUPAC name is 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(cyclopropylmethyl)urea.
| Compound Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(cyclopropylmethyl)urea |
|---|---|
| PubChem CID | 3867881 |
| Molecular Formula | C12H12ClF3N2O |
| Molecular Weight | 292.69 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1-[4-chloro-2-(trifluoromethyl)phenyl]-3-(cyclopropylmethyl)urea |
| SMILES | O=C(NCC1CC1)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C12H12ClF3N2O/c13-8-3-4-10(9(5-8)12(14,15)16)18-11(19)17-6-7-1-2-7/h3-5,7H,1-2,6H2,(H2,17,18,19) |
| InChIKey | IYBITUZISOEKGK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.69 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |